* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(2,3-DIMETHYLPIPERIDIN-1-YL)PENTAN-1-AMINE |
| English Synonyms: | 4-(2,3-DIMETHYLPIPERIDIN-1-YL)PENTAN-1-AMINE |
| MDL Number.: | MFCD16758613 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1CCCN(C1C)C(C)CCCN |
| InChi: | InChI=1S/C12H26N2/c1-10-6-5-9-14(12(10)3)11(2)7-4-8-13/h10-12H,4-9,13H2,1-3H3 |
| InChiKey: | InChIKey=WCJSLSFDDQKXEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.