* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(2,3-DIHYDRO-1H-ISOINDOL-2-YL)PENTAN-1-AMINE |
English Synonyms: | 4-(2,3-DIHYDRO-1H-ISOINDOL-2-YL)PENTAN-1-AMINE |
MDL Number.: | MFCD16758624 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(CCCN)N1Cc2ccccc2C1 |
InChi: | InChI=1S/C13H20N2/c1-11(5-4-8-14)15-9-12-6-2-3-7-13(12)10-15/h2-3,6-7,11H,4-5,8-10,14H2,1H3 |
InChiKey: | InChIKey=CJKGCYWBDPKIJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.