* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34287130 |
English Synonyms: | UKRORGSYN-BB BBV-34287130 |
MDL Number.: | MFCD16759275 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1c(cc(o1)CN)CN(C)C(C)C |
InChi: | InChI=1S/C11H20N2O/c1-8(2)13(4)7-10-5-11(6-12)14-9(10)3/h5,8H,6-7,12H2,1-4H3 |
InChiKey: | InChIKey=RMTCYQVFJXKLRU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.