* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34305819 |
English Synonyms: | UKRORGSYN-BB BBV-34305819 |
MDL Number.: | MFCD16771809 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCN(CCn1cc(nn1)CNC)C2CC2 |
InChi: | InChI=1S/C11H21N5/c1-3-15(11-4-5-11)6-7-16-9-10(8-12-2)13-14-16/h9,11-12H,3-8H2,1-2H3 |
InChiKey: | InChIKey=FJOKFVHCZTYYOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.