* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34306635 |
English Synonyms: | UKRORGSYN-BB BBV-34306635 |
MDL Number.: | MFCD16772398 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1CCN(C1)CCn2cc(nn2)CNC |
InChi: | InChI=1S/C11H21N5/c1-10-3-4-15(8-10)5-6-16-9-11(7-12-2)13-14-16/h9-10,12H,3-8H2,1-2H3 |
InChiKey: | InChIKey=BLJRATACXVLAEI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.