* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34307572 |
English Synonyms: | UKRORGSYN-BB BBV-34307572 |
MDL Number.: | MFCD16773030 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(CCCNC)N(C)Cc1cnn(c1)C |
InChi: | InChI=1S/C12H24N4/c1-11(6-5-7-13-2)15(3)9-12-8-14-16(4)10-12/h8,10-11,13H,5-7,9H2,1-4H3 |
InChiKey: | InChIKey=DIAOFLPJLNGOLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.