* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34307581 |
English Synonyms: | UKRORGSYN-BB BBV-34307581 |
MDL Number.: | MFCD16773034 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC(CNCC)N(CC)Cc1ccco1 |
InChi: | InChI=1S/C13H24N2O/c1-4-12(10-14-5-2)15(6-3)11-13-8-7-9-16-13/h7-9,12,14H,4-6,10-11H2,1-3H3 |
InChiKey: | InChIKey=WSKGLWNZIJWWRR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.