* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308347 |
English Synonyms: | UKRORGSYN-BB BBV-34308347 |
MDL Number.: | MFCD16773636 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCNCc1cc(on1)COCCCOC |
InChi: | InChI=1S/C11H20N2O3/c1-3-12-8-10-7-11(16-13-10)9-15-6-4-5-14-2/h7,12H,3-6,8-9H2,1-2H3 |
InChiKey: | InChIKey=QOGUTPOYSGCCFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.