* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308381 |
English Synonyms: | UKRORGSYN-BB BBV-34308381 |
MDL Number.: | MFCD16773658 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C=C/c1ccccc1OC(CN)C(C)C |
InChi: | InChI=1S/C14H21NO/c1-4-7-12-8-5-6-9-13(12)16-14(10-15)11(2)3/h4-9,11,14H,10,15H2,1-3H3/b7-4+ |
InChiKey: | InChIKey=IOZBXNGMCUPXEJ-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.