* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308382 |
English Synonyms: | UKRORGSYN-BB BBV-34308382 |
MDL Number.: | MFCD16773659 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C=C/c1ccccc1OCCCCCN |
InChi: | InChI=1S/C14H21NO/c1-2-8-13-9-4-5-10-14(13)16-12-7-3-6-11-15/h2,4-5,8-10H,3,6-7,11-12,15H2,1H3/b8-2+ |
InChiKey: | InChIKey=RMYXSCISZDQWQE-KRXBUXKQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.