* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308394 |
English Synonyms: | UKRORGSYN-BB BBV-34308394 |
MDL Number.: | MFCD16773671 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)(C)NCc1ccc(o1)COCC=C |
InChi: | InChI=1S/C13H21NO2/c1-5-8-15-10-12-7-6-11(16-12)9-14-13(2,3)4/h5-7,14H,1,8-10H2,2-4H3 |
InChiKey: | InChIKey=GZIJUGCFHIVVMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.