* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308395 |
English Synonyms: | UKRORGSYN-BB BBV-34308395 |
MDL Number.: | MFCD16773672 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)CNCc1ccc(o1)COCC=C |
InChi: | InChI=1S/C13H21NO2/c1-4-7-15-10-13-6-5-12(16-13)9-14-8-11(2)3/h4-6,11,14H,1,7-10H2,2-3H3 |
InChiKey: | InChIKey=AGKBUPGKSCVVOQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.