* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308397 |
English Synonyms: | UKRORGSYN-BB BBV-34308397 |
MDL Number.: | MFCD16773674 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)(C)NCc1cc(on1)COCC=C |
InChi: | InChI=1S/C12H20N2O2/c1-5-6-15-9-11-7-10(14-16-11)8-13-12(2,3)4/h5,7,13H,1,6,8-9H2,2-4H3 |
InChiKey: | InChIKey=GGAKLGKQNXPMMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.