* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308403 |
English Synonyms: | UKRORGSYN-BB BBV-34308403 |
MDL Number.: | MFCD16773680 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)NCc1cn(nn1)CCOCC=C |
InChi: | InChI=1S/C11H20N4O/c1-4-6-16-7-5-15-9-11(13-14-15)8-12-10(2)3/h4,9-10,12H,1,5-8H2,2-3H3 |
InChiKey: | InChIKey=FVWAGTGTLZMMLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.