* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34308404 |
English Synonyms: | UKRORGSYN-BB BBV-34308404 |
MDL Number.: | MFCD16773681 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C=CCOCCn1cc(nn1)CNC2CC2 |
InChi: | InChI=1S/C11H18N4O/c1-2-6-16-7-5-15-9-11(13-14-15)8-12-10-3-4-10/h2,9-10,12H,1,3-8H2 |
InChiKey: | InChIKey=GGJQSZCFWSVHGL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.