* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34309985 |
English Synonyms: | UKRORGSYN-BB BBV-34309985 |
MDL Number.: | MFCD16774942 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(C)OCc1cc(no1)CNC(C)C |
InChi: | InChI=1S/C12H22N2O2/c1-5-10(4)15-8-12-6-11(14-16-12)7-13-9(2)3/h6,9-10,13H,5,7-8H2,1-4H3 |
InChiKey: | InChIKey=QWXLFPMQWAFVMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.