* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34312737 |
English Synonyms: | UKRORGSYN-BB BBV-34312737 |
MDL Number.: | MFCD16777405 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(nc(n1)Cl)NCCn2cccn2 |
InChi: | InChI=1S/C10H12ClN5/c1-8-7-9(15-10(11)14-8)12-4-6-16-5-2-3-13-16/h2-3,5,7H,4,6H2,1H3,(H,12,14,15) |
InChiKey: | InChIKey=OGTAUYGLMHIOMF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.