* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34313336 |
English Synonyms: | UKRORGSYN-BB BBV-34313336 |
MDL Number.: | MFCD16777986 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOCCCn1cnc2c1ccc(c2)N |
InChi: | InChI=1S/C12H17N3O/c1-2-16-7-3-6-15-9-14-11-8-10(13)4-5-12(11)15/h4-5,8-9H,2-3,6-7,13H2,1H3 |
InChiKey: | InChIKey=ZKMGUWKUFKEUSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.