* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34313344 |
English Synonyms: | UKRORGSYN-BB BBV-34313344 |
MDL Number.: | MFCD16777994 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1N)ncn2CC3CCCO3 |
InChi: | InChI=1S/C12H15N3O/c13-9-3-4-12-11(6-9)14-8-15(12)7-10-2-1-5-16-10/h3-4,6,8,10H,1-2,5,7,13H2 |
InChiKey: | InChIKey=QIBGGAQIWHPFIA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.