* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34313972 |
English Synonyms: | UKRORGSYN-BB BBV-34313972 |
MDL Number.: | MFCD16778555 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc(ccc1CCl)n2ccc(n2)C3CC3 |
InChi: | InChI=1S/C13H13ClN2/c14-9-10-1-5-12(6-2-10)16-8-7-13(15-16)11-3-4-11/h1-2,5-8,11H,3-4,9H2 |
InChiKey: | InChIKey=ZSQPNLVDHKOQSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.