* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34313999 |
English Synonyms: | UKRORGSYN-BB BBV-34313999 |
MDL Number.: | MFCD16778581 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ncc1CO)n2ccc(n2)C3CC3 |
InChi: | InChI=1S/C12H13N3O/c16-8-9-1-4-12(13-7-9)15-6-5-11(14-15)10-2-3-10/h1,4-7,10,16H,2-3,8H2 |
InChiKey: | InChIKey=CTRSNMABPHHCBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.