* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-38115997 |
English Synonyms: | UKRORGSYN-BB BBV-38115997 |
MDL Number.: | MFCD16779875 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cn1cnnc1Sc2cccc(c2CN)Cl |
InChi: | InChI=1S/C10H11ClN4S/c1-15-6-13-14-10(15)16-9-4-2-3-8(11)7(9)5-12/h2-4,6H,5,12H2,1H3 |
InChiKey: | InChIKey=KXVSEOPBGVYYCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.