* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(4-PROPOXYPHENYL)-1,2,4-THIADIAZOL-5-AMINE |
| English Synonyms: | 3-(4-PROPOXYPHENYL)-1,2,4-THIADIAZOL-5-AMINE |
| MDL Number.: | MFCD16780315 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCOc1ccc(cc1)c2nc(sn2)N |
| InChi: | InChI=1S/C11H13N3OS/c1-2-7-15-9-5-3-8(4-6-9)10-13-11(12)16-14-10/h3-6H,2,7H2,1H3,(H2,12,13,14) |
| InChiKey: | InChIKey=QKMPVJSXTLQOAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.