* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AMINO-1-(3-PROPOXYPHENYL)BUTAN-1-OL |
English Synonyms: | 2-AMINO-1-(3-PROPOXYPHENYL)BUTAN-1-OL |
MDL Number.: | MFCD16780364 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCOc1cccc(c1)C(C(CC)N)O |
InChi: | InChI=1S/C13H21NO2/c1-3-8-16-11-7-5-6-10(9-11)13(15)12(14)4-2/h5-7,9,12-13,15H,3-4,8,14H2,1-2H3 |
InChiKey: | InChIKey=XSVBUIVJZXIABE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.