* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(3-PROPOXYPHENYL)-4,5-DIHYDRO-1,2,4-OXADIAZOL-5-ONE |
| English Synonyms: | 3-(3-PROPOXYPHENYL)-4,5-DIHYDRO-1,2,4-OXADIAZOL-5-ONE |
| MDL Number.: | MFCD16780371 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCOc1cccc(c1)c2[nH]c(=O)on2 |
| InChi: | InChI=1S/C11H12N2O3/c1-2-6-15-9-5-3-4-8(7-9)10-12-11(14)16-13-10/h3-5,7H,2,6H2,1H3,(H,12,13,14) |
| InChiKey: | InChIKey=STCYEMOVTWITRS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.