* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(3-PROPOXYPHENYL)-1,3-THIAZOL-5-AMINE |
| English Synonyms: | 4-(3-PROPOXYPHENYL)-1,3-THIAZOL-5-AMINE |
| MDL Number.: | MFCD16780382 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCOc1cccc(c1)c2c(scn2)N |
| InChi: | InChI=1S/C12H14N2OS/c1-2-6-15-10-5-3-4-9(7-10)11-12(13)16-8-14-11/h3-5,7-8H,2,6,13H2,1H3 |
| InChiKey: | InChIKey=SUXATRZEYAFWJH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.