* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-PROPOXYPHENYL)-1,3-THIAZOLIDINE |
English Synonyms: | 2-(3-PROPOXYPHENYL)-1,3-THIAZOLIDINE |
MDL Number.: | MFCD16780383 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCOc1cccc(c1)C2NCCS2 |
InChi: | InChI=1S/C12H17NOS/c1-2-7-14-11-5-3-4-10(9-11)12-13-6-8-15-12/h3-5,9,12-13H,2,6-8H2,1H3 |
InChiKey: | InChIKey=JPLVRAGOSKUFFH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.