* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-AMINO-3-(3-PROPOXYPHENYL)PROPAN-1-OL |
| English Synonyms: | 3-AMINO-3-(3-PROPOXYPHENYL)PROPAN-1-OL |
| MDL Number.: | MFCD16780388 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCOc1cccc(c1)C(CCO)N |
| InChi: | InChI=1S/C12H19NO2/c1-2-8-15-11-5-3-4-10(9-11)12(13)6-7-14/h3-5,9,12,14H,2,6-8,13H2,1H3 |
| InChiKey: | InChIKey=QFGXVKHPMYUXDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.