* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2,2-TRIFLUORO-1-(3-PROPOXYPHENYL)ETHAN-1-OL |
English Synonyms: | 2,2,2-TRIFLUORO-1-(3-PROPOXYPHENYL)ETHAN-1-OL |
MDL Number.: | MFCD16780397 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCOc1cccc(c1)C(C(F)(F)F)O |
InChi: | InChI=1S/C11H13F3O2/c1-2-6-16-9-5-3-4-8(7-9)10(15)11(12,13)14/h3-5,7,10,15H,2,6H2,1H3 |
InChiKey: | InChIKey=ZIAAMSOWYBDBOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.