Molecular Structure:
CCD No.:CCD03160492
OTAVA-BB 2083557
Formula:C12 H13 N O
MolWeight:187.241
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2083557 |
| English Synonyms： | OTAVA-BB 2083557 |
| MDL Number.： | MFCD16780398 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | CCCOc1cccc(c1)/C=C/C#N |
| InChi： | InChI=1S/C12H13NO/c1-2-9-14-12-7-3-5-11(10-12)6-4-8-13/h3-7,10H,2,9H2,1H3/b6-4+ |
| InChiKey： | InChIKey=RRPGYEHLBPPWIH-GQCTYLIASA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
