* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 2083557 |
English Synonyms: | OTAVA-BB 2083557 |
MDL Number.: | MFCD16780398 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCOc1cccc(c1)/C=C/C#N |
InChi: | InChI=1S/C12H13NO/c1-2-9-14-12-7-3-5-11(10-12)6-4-8-13/h3-7,10H,2,9H2,1H3/b6-4+ |
InChiKey: | InChIKey=RRPGYEHLBPPWIH-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.