* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-AMINOPHENYL)-N-(1,3,4-THIADIAZOL-2-YL)ACETAMIDE |
English Synonyms: | 2-(3-AMINOPHENYL)-N-(1,3,4-THIADIAZOL-2-YL)ACETAMIDE |
MDL Number.: | MFCD16780411 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(cc(c1)N)CC(=O)Nc2nncs2 |
InChi: | InChI=1S/C10H10N4OS/c11-8-3-1-2-7(4-8)5-9(15)13-10-14-12-6-16-10/h1-4,6H,5,11H2,(H,13,14,15) |
InChiKey: | InChIKey=PBDIGBINIUTURM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.