* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-FLUORO-1-N-(PROP-2-EN-1-YL)BENZENE-1,2-DIAMINE |
English Synonyms: | 4-FLUORO-1-N-(PROP-2-EN-1-YL)BENZENE-1,2-DIAMINE |
MDL Number.: | MFCD16780451 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C=CCNc1ccc(cc1N)F |
InChi: | InChI=1S/C9H11FN2/c1-2-5-12-9-4-3-7(10)6-8(9)11/h2-4,6,12H,1,5,11H2 |
InChiKey: | InChIKey=SZSIOLRVXFJZGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.