* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-N-(PROP-2-EN-1-YL)-2,3-DIHYDRO-1,4-BENZODIOXINE-6,7-DIAMINE |
English Synonyms: | 6-N-(PROP-2-EN-1-YL)-2,3-DIHYDRO-1,4-BENZODIOXINE-6,7-DIAMINE |
MDL Number.: | MFCD16780452 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C=CCNc1cc2c(cc1N)OCCO2 |
InChi: | InChI=1S/C11H14N2O2/c1-2-3-13-9-7-11-10(6-8(9)12)14-4-5-15-11/h2,6-7,13H,1,3-5,12H2 |
InChiKey: | InChIKey=OGRIECGXTHPDNX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.