* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-ETHOXY-2-N-(PROP-2-EN-1-YL)PYRIDINE-2,5-DIAMINE |
| English Synonyms: | 6-ETHOXY-2-N-(PROP-2-EN-1-YL)PYRIDINE-2,5-DIAMINE |
| MDL Number.: | MFCD16780458 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCOc1c(ccc(n1)NCC=C)N |
| InChi: | InChI=1S/C10H15N3O/c1-3-7-12-9-6-5-8(11)10(13-9)14-4-2/h3,5-6H,1,4,7,11H2,2H3,(H,12,13) |
| InChiKey: | InChIKey=OWMDHKMIXUOALK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.