* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-AMINO-7-[(PROP-2-EN-1-YL)AMINO]-1,2,3,4-TETRAHYDROQUINOLIN-2-ONE |
| English Synonyms: | 6-AMINO-7-[(PROP-2-EN-1-YL)AMINO]-1,2,3,4-TETRAHYDROQUINOLIN-2-ONE |
| MDL Number.: | MFCD16780466 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | C=CCNc1cc2c(cc1N)CCC(=O)N2 |
| InChi: | InChI=1S/C12H15N3O/c1-2-5-14-11-7-10-8(6-9(11)13)3-4-12(16)15-10/h2,6-7,14H,1,3-5,13H2,(H,15,16) |
| InChiKey: | InChIKey=WHRMWGMSNNSKNP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.