* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-AMINO-4-[(PROP-2-EN-1-YL)AMINO]BENZAMIDE |
English Synonyms: | 3-AMINO-4-[(PROP-2-EN-1-YL)AMINO]BENZAMIDE |
MDL Number.: | MFCD16780470 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C=CCNc1ccc(cc1N)C(=O)N |
InChi: | InChI=1S/C10H13N3O/c1-2-5-13-9-4-3-7(10(12)14)6-8(9)11/h2-4,6,13H,1,5,11H2,(H2,12,14) |
InChiKey: | InChIKey=ULMASUCFXZCICU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.