* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-METHYL-5-N-(PROP-2-EN-1-YL)-1,3-BENZOTHIAZOLE-5,6-DIAMINE |
English Synonyms: | 2-METHYL-5-N-(PROP-2-EN-1-YL)-1,3-BENZOTHIAZOLE-5,6-DIAMINE |
MDL Number.: | MFCD16780473 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1nc2cc(c(cc2s1)N)NCC=C |
InChi: | InChI=1S/C11H13N3S/c1-3-4-13-9-6-10-11(5-8(9)12)15-7(2)14-10/h3,5-6,13H,1,4,12H2,2H3 |
InChiKey: | InChIKey=MQVZJDGHKOYEQP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.