* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-AMINO-6-[(PROP-2-EN-1-YL)AMINO]-2,3-DIHYDRO-1H-INDOL-2-ONE |
| English Synonyms: | 5-AMINO-6-[(PROP-2-EN-1-YL)AMINO]-2,3-DIHYDRO-1H-INDOL-2-ONE |
| MDL Number.: | MFCD16780474 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | C=CCNc1cc2c(cc1N)CC(=O)N2 |
| InChi: | InChI=1S/C11H13N3O/c1-2-3-13-10-6-9-7(4-8(10)12)5-11(15)14-9/h2,4,6,13H,1,3,5,12H2,(H,14,15) |
| InChiKey: | InChIKey=WVIAZENMOQWZDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.