* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-N-(PROP-2-EN-1-YL)QUINOLINE-5,8-DIAMINE |
| English Synonyms: | 5-N-(PROP-2-EN-1-YL)QUINOLINE-5,8-DIAMINE |
| MDL Number.: | MFCD16780475 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C=CCNc1ccc(c2c1cccn2)N |
| InChi: | InChI=1S/C12H13N3/c1-2-7-14-11-6-5-10(13)12-9(11)4-3-8-15-12/h2-6,8,14H,1,7,13H2 |
| InChiKey: | InChIKey=BZFYLQVKIYXMJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.