* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34316328 |
English Synonyms: | UKRORGSYN-BB BBV-34316328 |
MDL Number.: | MFCD16780478 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C=CCNc1ccc(c2c1non2)N |
InChi: | InChI=1S/C9H10N4O/c1-2-5-11-7-4-3-6(10)8-9(7)13-14-12-8/h2-4,11H,1,5,10H2 |
InChiKey: | InChIKey=LSOQQWHSMMBYNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.