* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-AMINO-4-[(PROP-2-EN-1-YL)AMINO]BENZONITRILE |
| English Synonyms: | 3-AMINO-4-[(PROP-2-EN-1-YL)AMINO]BENZONITRILE |
| MDL Number.: | MFCD16780479 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C=CCNc1ccc(cc1N)C#N |
| InChi: | InChI=1S/C10H11N3/c1-2-5-13-10-4-3-8(7-11)6-9(10)12/h2-4,6,13H,1,5,12H2 |
| InChiKey: | InChIKey=TYMACDNHPNMFOX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.