* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-BROMO-4-N-(PROP-2-EN-1-YL)QUINOLINE-3,4-DIAMINE |
| English Synonyms: | 6-BROMO-4-N-(PROP-2-EN-1-YL)QUINOLINE-3,4-DIAMINE |
| MDL Number.: | MFCD16780481 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C=CCNc1c2cc(ccc2ncc1N)Br |
| InChi: | InChI=1S/C12H12BrN3/c1-2-5-15-12-9-6-8(13)3-4-11(9)16-7-10(12)14/h2-4,6-7H,1,5,14H2,(H,15,16) |
| InChiKey: | InChIKey=JJEBLTBWCNOGAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.