* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-N-(PROP-2-EN-1-YL)QUINOLINE-5,6-DIAMINE |
English Synonyms: | 6-N-(PROP-2-EN-1-YL)QUINOLINE-5,6-DIAMINE |
MDL Number.: | MFCD16780483 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C=CCNc1ccc2c(c1N)cccn2 |
InChi: | InChI=1S/C12H13N3/c1-2-7-14-11-6-5-10-9(12(11)13)4-3-8-15-10/h2-6,8,14H,1,7,13H2 |
InChiKey: | InChIKey=WPGQNWASIPVXSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.