* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,6-DIFLUORO-1-N-(PROP-2-EN-1-YL)BENZENE-1,4-DIAMINE |
English Synonyms: | 2,6-DIFLUORO-1-N-(PROP-2-EN-1-YL)BENZENE-1,4-DIAMINE |
MDL Number.: | MFCD16780487 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C=CCNc1c(cc(cc1F)N)F |
InChi: | InChI=1S/C9H10F2N2/c1-2-3-13-9-7(10)4-6(12)5-8(9)11/h2,4-5,13H,1,3,12H2 |
InChiKey: | InChIKey=MHYDGUROYQNILO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.