* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34316400 |
English Synonyms: | UKRORGSYN-BB BBV-34316400 |
MDL Number.: | MFCD16780525 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C=CCn1ccc(n1)N |
InChi: | InChI=1S/C6H9N3/c1-2-4-9-5-3-6(7)8-9/h2-3,5H,1,4H2,(H2,7,8) |
InChiKey: | InChIKey=FSNPHGVOUBOZTE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.