* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34316402 |
English Synonyms: | UKRORGSYN-BB BBV-34316402 |
MDL Number.: | MFCD16780527 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C=CCn1cnc(n1)N |
InChi: | InChI=1S/C5H8N4/c1-2-3-9-4-7-5(6)8-9/h2,4H,1,3H2,(H2,6,8) |
InChiKey: | InChIKey=BKDXKMFCDVSUKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.