* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(2-METHOXY-5-METHYLPHENYL)-4H-1,2,4-TRIAZOL-3-AMINE |
| English Synonyms: | 5-(2-METHOXY-5-METHYLPHENYL)-4H-1,2,4-TRIAZOL-3-AMINE |
| MDL Number.: | MFCD16781007 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(c(c1)c2[nH]c(nn2)N)OC |
| InChi: | InChI=1S/C10H12N4O/c1-6-3-4-8(15-2)7(5-6)9-12-10(11)14-13-9/h3-5H,1-2H3,(H3,11,12,13,14) |
| InChiKey: | InChIKey=GWBXGQYTYNZLHK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.