* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(2-METHOXY-5-METHYL-PHENYL)-1,3,4-THIADIAZOL-2-AMINE |
English Synonyms: | 5-(2-METHOXY-5-METHYL-PHENYL)-1,3,4-THIADIAZOL-2-AMINE |
MDL Number.: | MFCD16781016 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)c2nnc(s2)N)OC |
InChi: | InChI=1S/C10H11N3OS/c1-6-3-4-8(14-2)7(5-6)9-12-13-10(11)15-9/h3-5H,1-2H3,(H2,11,13) |
InChiKey: | InChIKey=YGPZAXFIFZDCDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.