* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(2-METHOXY-5-METHYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL |
English Synonyms: | 5-(2-METHOXY-5-METHYLPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL |
MDL Number.: | MFCD16781029 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)c2[nH]c(nn2)S)OC |
InChi: | InChI=1S/C10H11N3OS/c1-6-3-4-8(14-2)7(5-6)9-11-10(15)13-12-9/h3-5H,1-2H3,(H2,11,12,13,15) |
InChiKey: | InChIKey=RUUNOJDAXPTDFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.