* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-[(3-CHLOROPHENYL)METHYL]-3-PROPYL-1H-1,2,4-TRIAZOLE |
| English Synonyms: | 5-[(3-CHLOROPHENYL)METHYL]-3-PROPYL-1H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD16781136 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCc1nc([nH]n1)Cc2cccc(c2)Cl |
| InChi: | InChI=1S/C12H14ClN3/c1-2-4-11-14-12(16-15-11)8-9-5-3-6-10(13)7-9/h3,5-7H,2,4,8H2,1H3,(H,14,15,16) |
| InChiKey: | InChIKey=ONIVHQNZQHXQCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.